C25H34F3N5O — CID 133073695
1-[(1S,14R)-17-(3-methylbutyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-[3-(trifluoromethyl)pyrazol-1-yl]ethanone (PubChem CID 133073695) has the molecular formula C25H34F3N5O and a molecular weight of 477.58 g/mol. Its IUPAC name is 1-[(1S,14R)-17-(3-methylbutyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-[3-(trifluoromethyl)pyrazol-1-yl]ethanone.
| Compound Name | 1-[(1S,14R)-17-(3-methylbutyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-[3-(trifluoromethyl)pyrazol-1-yl]ethanone |
|---|---|
| PubChem CID | 133073695 |
| Molecular Formula | C25H34F3N5O |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | 1-[(1S,14R)-17-(3-methylbutyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-[3-(trifluoromethyl)pyrazol-1-yl]ethanone |
| SMILES | CC(C)CCN1[C@H]2CCNc3ccccc3CN(C(=O)Cn3ccc(C(F)(F)F)n3)C[C@@H]1CC2 |
| InChI | InChI=1S/C25H34F3N5O/c1-18(2)10-14-33-20-7-8-21(33)16-31(15-19-5-3-4-6-22(19)29-12-9-20)24(34)17-32-13-11-23(30-32)25(26,27)28/h3-6,11,13,18,20-21,29H,7-10,12,14-17H2,1-2H3/t20-,21+/m1/s1 |
| InChIKey | HVCXZWLRBDXRRC-RTWAWAEBSA-N |
| XLogP | 4.63 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |