C26H35N3O — CID 110069813
2-(2-methylphenyl)-1-[(1S,14R)-17-propan-2-yl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]ethanone (PubChem CID 110069813) has the molecular formula C26H35N3O and a molecular weight of 405.59 g/mol. Its IUPAC name is 2-(2-methylphenyl)-1-[(1S,14R)-17-propan-2-yl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]ethanone.
| Compound Name | 2-(2-methylphenyl)-1-[(1S,14R)-17-propan-2-yl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]ethanone |
|---|---|
| PubChem CID | 110069813 |
| Molecular Formula | C26H35N3O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | 2-(2-methylphenyl)-1-[(1S,14R)-17-propan-2-yl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]ethanone |
| SMILES | Cc1ccccc1CC(=O)N1Cc2ccccc2NCC[C@H]2CC[C@@H](C1)N2C(C)C |
| InChI | InChI=1S/C26H35N3O/c1-19(2)29-23-12-13-24(29)18-28(26(30)16-21-9-5-4-8-20(21)3)17-22-10-6-7-11-25(22)27-15-14-23/h4-11,19,23-24,27H,12-18H2,1-3H3/t23-,24+/m1/s1 |
| InChIKey | PXQKCTAKRSIENH-RPWUZVMVSA-N |
| XLogP | 4.62 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |