C24H30FN3O — CID 110071915
(3-fluorophenyl)-[(1S,14R)-17-propan-2-yl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]methanone (PubChem CID 110071915) has the molecular formula C24H30FN3O and a molecular weight of 395.52 g/mol. Its IUPAC name is (3-fluorophenyl)-[(1S,14R)-17-propan-2-yl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]methanone.
| Compound Name | (3-fluorophenyl)-[(1S,14R)-17-propan-2-yl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]methanone |
|---|---|
| PubChem CID | 110071915 |
| Molecular Formula | C24H30FN3O |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | (3-fluorophenyl)-[(1S,14R)-17-propan-2-yl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]methanone |
| SMILES | CC(C)N1[C@H]2CCNc3ccccc3CN(C(=O)c3cccc(F)c3)C[C@@H]1CC2 |
| InChI | InChI=1S/C24H30FN3O/c1-17(2)28-21-10-11-22(28)16-27(24(29)18-7-5-8-20(25)14-18)15-19-6-3-4-9-23(19)26-13-12-21/h3-9,14,17,21-22,26H,10-13,15-16H2,1-2H3/t21-,22+/m1/s1 |
| InChIKey | PRKAWOWXVBPIAQ-YADHBBJMSA-N |
| XLogP | 4.53 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |