C22H31N5O — CID 110075347
[(1R,14S)-17-methyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-(1-propylpyrazol-3-yl)methanone (PubChem CID 110075347) has the molecular formula C22H31N5O and a molecular weight of 381.52 g/mol. Its IUPAC name is [(1R,14S)-17-methyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-(1-propylpyrazol-3-yl)methanone.
| Compound Name | [(1R,14S)-17-methyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-(1-propylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 110075347 |
| Molecular Formula | C22H31N5O |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | [(1R,14S)-17-methyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-(1-propylpyrazol-3-yl)methanone |
| SMILES | CCCn1ccc(C(=O)N2Cc3ccccc3NCC[C@@H]3CC[C@H](C2)N3C)n1 |
| InChI | InChI=1S/C22H31N5O/c1-3-13-27-14-11-21(24-27)22(28)26-15-17-6-4-5-7-20(17)23-12-10-18-8-9-19(16-26)25(18)2/h4-7,11,14,18-19,23H,3,8-10,12-13,15-16H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | KEOGTJIIOYUBHP-RBUKOAKNSA-N |
| XLogP | 3.21 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |