C28H38N4O2 — CID 110075328
[(1R,14S)-17-methyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-[2-(2-pyrrolidin-1-ylethoxy)phenyl]methanone (PubChem CID 110075328) has the molecular formula C28H38N4O2 and a molecular weight of 462.64 g/mol. Its IUPAC name is [(1R,14S)-17-methyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-[2-(2-pyrrolidin-1-ylethoxy)phenyl]methanone.
| Compound Name | [(1R,14S)-17-methyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-[2-(2-pyrrolidin-1-ylethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 110075328 |
| Molecular Formula | C28H38N4O2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | [(1R,14S)-17-methyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-[2-(2-pyrrolidin-1-ylethoxy)phenyl]methanone |
| SMILES | CN1[C@@H]2CCNc3ccccc3CN(C(=O)c3ccccc3OCCN3CCCC3)C[C@H]1CC2 |
| InChI | InChI=1S/C28H38N4O2/c1-30-23-12-13-24(30)21-32(20-22-8-2-4-10-26(22)29-15-14-23)28(33)25-9-3-5-11-27(25)34-19-18-31-16-6-7-17-31/h2-5,8-11,23-24,29H,6-7,12-21H2,1H3/t23-,24+/m0/s1 |
| InChIKey | MFELRPLJPAJKKX-BJKOFHAPSA-N |
| XLogP | 4.08 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |