C25H34N4O3S — CID 110075355
N-methyl-4-[3-[(1R,14S)-17-methyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-3-oxopropyl]benzenesulfonamide (PubChem CID 110075355) has the molecular formula C25H34N4O3S and a molecular weight of 470.64 g/mol. Its IUPAC name is N-methyl-4-[3-[(1R,14S)-17-methyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-3-oxopropyl]benzenesulfonamide.
| Compound Name | N-methyl-4-[3-[(1R,14S)-17-methyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-3-oxopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110075355 |
| Molecular Formula | C25H34N4O3S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | N-methyl-4-[3-[(1R,14S)-17-methyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-3-oxopropyl]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(CCC(=O)N2Cc3ccccc3NCC[C@@H]3CC[C@H](C2)N3C)cc1 |
| InChI | InChI=1S/C25H34N4O3S/c1-26-33(31,32)23-12-7-19(8-13-23)9-14-25(30)29-17-20-5-3-4-6-24(20)27-16-15-21-10-11-22(18-29)28(21)2/h3-8,12-13,21-22,26-27H,9-11,14-18H2,1-2H3/t21-,22+/m0/s1 |
| InChIKey | HYLGNFLVJLHVCO-FCHUYYIVSA-N |
| XLogP | 2.83 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |