C25H32ClN3O — CID 110069255
3-(4-chlorophenyl)-1-(9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)propan-1-one (PubChem CID 110069255) has the molecular formula C25H32ClN3O and a molecular weight of 426.00 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)propan-1-one.
| Compound Name | 3-(4-chlorophenyl)-1-(9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)propan-1-one |
|---|---|
| PubChem CID | 110069255 |
| Molecular Formula | C25H32ClN3O |
| Molecular Weight | 426.00 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)propan-1-one |
| SMILES | Cc1cccc2c1NCCC1CCC(CN(C(=O)CCc3ccc(Cl)cc3)C2)N1C |
| InChI | InChI=1S/C25H32ClN3O/c1-18-4-3-5-20-16-29(24(30)13-8-19-6-9-21(26)10-7-19)17-23-12-11-22(28(23)2)14-15-27-25(18)20/h3-7,9-10,22-23,27H,8,11-17H2,1-2H3 |
| InChIKey | ZAQIIJNGAGVOQG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.00 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |