C22H32N6O — CID 110069217
1-(9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)-4-(1,2,4-triazol-1-yl)butan-1-one (PubChem CID 110069217) has the molecular formula C22H32N6O and a molecular weight of 396.54 g/mol. Its IUPAC name is 1-(9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)-4-(1,2,4-triazol-1-yl)butan-1-one.
| Compound Name | 1-(9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)-4-(1,2,4-triazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 110069217 |
| Molecular Formula | C22H32N6O |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 1-(9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)-4-(1,2,4-triazol-1-yl)butan-1-one |
| SMILES | Cc1cccc2c1NCCC1CCC(CN(C(=O)CCCn3cncn3)C2)N1C |
| InChI | InChI=1S/C22H32N6O/c1-17-5-3-6-18-13-27(21(29)7-4-12-28-16-23-15-25-28)14-20-9-8-19(26(20)2)10-11-24-22(17)18/h3,5-6,15-16,19-20,24H,4,7-14H2,1-2H3 |
| InChIKey | LQQDBOSULDTSPI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |