C25H37N5O — CID 110071860
(9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)-[1-methyl-3-(2-methylpropyl)pyrazol-5-yl]methanone (PubChem CID 110071860) has the molecular formula C25H37N5O and a molecular weight of 423.61 g/mol. Its IUPAC name is (9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)-[1-methyl-3-(2-methylpropyl)pyrazol-5-yl]methanone.
| Compound Name | (9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)-[1-methyl-3-(2-methylpropyl)pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 110071860 |
| Molecular Formula | C25H37N5O |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 423.30 |
| IUPAC Name | (9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)-[1-methyl-3-(2-methylpropyl)pyrazol-5-yl]methanone |
| SMILES | Cc1cccc2c1NCCC1CCC(CN(C(=O)c3cc(CC(C)C)nn3C)C2)N1C |
| InChI | InChI=1S/C25H37N5O/c1-17(2)13-20-14-23(29(5)27-20)25(31)30-15-19-8-6-7-18(3)24(19)26-12-11-21-9-10-22(16-30)28(21)4/h6-8,14,17,21-22,26H,9-13,15-16H2,1-5H3 |
| InChIKey | PHGDTTYKLQHIEY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |