C24H30N6O — CID 110069235
2-(benzotriazol-2-yl)-1-(9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)ethanone (PubChem CID 110069235) has the molecular formula C24H30N6O and a molecular weight of 418.55 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-1-(9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)ethanone.
| Compound Name | 2-(benzotriazol-2-yl)-1-(9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)ethanone |
|---|---|
| PubChem CID | 110069235 |
| Molecular Formula | C24H30N6O |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 2-(benzotriazol-2-yl)-1-(9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)ethanone |
| SMILES | Cc1cccc2c1NCCC1CCC(CN(C(=O)Cn3nc4ccccc4n3)C2)N1C |
| InChI | InChI=1S/C24H30N6O/c1-17-6-5-7-18-14-29(15-20-11-10-19(28(20)2)12-13-25-24(17)18)23(31)16-30-26-21-8-3-4-9-22(21)27-30/h3-9,19-20,25H,10-16H2,1-2H3 |
| InChIKey | YCJVEVRXEKCLTQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |