C26H38N6O2 — CID 155993263
1-(18-ethyl-11-propanoyl-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl)-4-(1,2,4-triazol-1-yl)butan-1-one (PubChem CID 155993263) has the molecular formula C26H38N6O2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 1-(18-ethyl-11-propanoyl-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl)-4-(1,2,4-triazol-1-yl)butan-1-one.
| Compound Name | 1-(18-ethyl-11-propanoyl-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl)-4-(1,2,4-triazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 155993263 |
| Molecular Formula | C26H38N6O2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | 1-(18-ethyl-11-propanoyl-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl)-4-(1,2,4-triazol-1-yl)butan-1-one |
| SMILES | CCC(=O)N1CCC2CCCC(CN(C(=O)CCCn3cncn3)Cc3ccccc31)N2CC |
| InChI | InChI=1S/C26H38N6O2/c1-3-25(33)32-16-14-22-10-7-11-23(31(22)4-2)18-29(17-21-9-5-6-12-24(21)32)26(34)13-8-15-30-20-27-19-28-30/h5-6,9,12,19-20,22-23H,3-4,7-8,10-11,13-18H2,1-2H3 |
| InChIKey | LRDKUPWHKGPPLP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |