C28H41N5O2 — CID 110071534
1-[18-(3-methylbutyl)-3-(2-methylpyrazole-3-carbonyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one (PubChem CID 110071534) has the molecular formula C28H41N5O2 and a molecular weight of 479.67 g/mol. Its IUPAC name is 1-[18-(3-methylbutyl)-3-(2-methylpyrazole-3-carbonyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one.
| Compound Name | 1-[18-(3-methylbutyl)-3-(2-methylpyrazole-3-carbonyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one |
|---|---|
| PubChem CID | 110071534 |
| Molecular Formula | C28H41N5O2 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.33 |
| IUPAC Name | 1-[18-(3-methylbutyl)-3-(2-methylpyrazole-3-carbonyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one |
| SMILES | CCC(=O)N1CCC2CCCC(CN(C(=O)c3ccnn3C)Cc3ccccc31)N2CCC(C)C |
| InChI | InChI=1S/C28H41N5O2/c1-5-27(34)33-18-15-23-10-8-11-24(32(23)17-14-21(2)3)20-31(19-22-9-6-7-12-25(22)33)28(35)26-13-16-29-30(26)4/h6-7,9,12-13,16,21,23-24H,5,8,10-11,14-15,17-20H2,1-4H3 |
| InChIKey | HDZZEKBLLGLRNJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |