C30H49N5O2 — CID 155993339
1-[18-(3-methylbutyl)-3-[2-(4-methylpiperazin-1-yl)acetyl]-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one (PubChem CID 155993339) has the molecular formula C30H49N5O2 and a molecular weight of 511.76 g/mol. Its IUPAC name is 1-[18-(3-methylbutyl)-3-[2-(4-methylpiperazin-1-yl)acetyl]-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one.
| Compound Name | 1-[18-(3-methylbutyl)-3-[2-(4-methylpiperazin-1-yl)acetyl]-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one |
|---|---|
| PubChem CID | 155993339 |
| Molecular Formula | C30H49N5O2 |
| Molecular Weight | 511.76 g/mol |
| Exact Mass | 511.39 |
| IUPAC Name | 1-[18-(3-methylbutyl)-3-[2-(4-methylpiperazin-1-yl)acetyl]-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one |
| SMILES | CCC(=O)N1CCC2CCCC(CN(C(=O)CN3CCN(C)CC3)Cc3ccccc31)N2CCC(C)C |
| InChI | InChI=1S/C30H49N5O2/c1-5-29(36)35-16-14-26-10-8-11-27(34(26)15-13-24(2)3)22-33(21-25-9-6-7-12-28(25)35)30(37)23-32-19-17-31(4)18-20-32/h6-7,9,12,24,26-27H,5,8,10-11,13-23H2,1-4H3 |
| InChIKey | SXYNTXRIMJUSAS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 50.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.76 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |