C30H48N4O2 — CID 155993340
1-[18-(3-methylbutyl)-3-(2-piperidin-1-ylacetyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one (PubChem CID 155993340) has the molecular formula C30H48N4O2 and a molecular weight of 496.74 g/mol. Its IUPAC name is 1-[18-(3-methylbutyl)-3-(2-piperidin-1-ylacetyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one.
| Compound Name | 1-[18-(3-methylbutyl)-3-(2-piperidin-1-ylacetyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one |
|---|---|
| PubChem CID | 155993340 |
| Molecular Formula | C30H48N4O2 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.38 |
| IUPAC Name | 1-[18-(3-methylbutyl)-3-(2-piperidin-1-ylacetyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one |
| SMILES | CCC(=O)N1CCC2CCCC(CN(C(=O)CN3CCCCC3)Cc3ccccc31)N2CCC(C)C |
| InChI | InChI=1S/C30H48N4O2/c1-4-29(35)34-20-16-26-12-10-13-27(33(26)19-15-24(2)3)22-32(21-25-11-6-7-14-28(25)34)30(36)23-31-17-8-5-9-18-31/h6-7,11,14,24,26-27H,4-5,8-10,12-13,15-23H2,1-3H3 |
| InChIKey | LVMDOPTZVGSGLN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |