C32H51N3O2 — CID 155993327
3-cyclohexyl-1-[18-(3-methylbutyl)-11-propanoyl-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]propan-1-one (PubChem CID 155993327) has the molecular formula C32H51N3O2 and a molecular weight of 509.78 g/mol. Its IUPAC name is 3-cyclohexyl-1-[18-(3-methylbutyl)-11-propanoyl-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]propan-1-one.
| Compound Name | 3-cyclohexyl-1-[18-(3-methylbutyl)-11-propanoyl-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]propan-1-one |
|---|---|
| PubChem CID | 155993327 |
| Molecular Formula | C32H51N3O2 |
| Molecular Weight | 509.78 g/mol |
| Exact Mass | 509.40 |
| IUPAC Name | 3-cyclohexyl-1-[18-(3-methylbutyl)-11-propanoyl-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]propan-1-one |
| SMILES | CCC(=O)N1CCC2CCCC(CN(C(=O)CCC3CCCCC3)Cc3ccccc31)N2CCC(C)C |
| InChI | InChI=1S/C32H51N3O2/c1-4-31(36)35-22-20-28-14-10-15-29(34(28)21-19-25(2)3)24-33(23-27-13-8-9-16-30(27)35)32(37)18-17-26-11-6-5-7-12-26/h8-9,13,16,25-26,28-29H,4-7,10-12,14-15,17-24H2,1-3H3 |
| InChIKey | FYVINBHIPQQANP-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.78 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |