C26H39N3O2 — CID 110071824
1-[3-(cyclohexanecarbonyl)-18-methyl-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one (PubChem CID 110071824) has the molecular formula C26H39N3O2 and a molecular weight of 425.62 g/mol. Its IUPAC name is 1-[3-(cyclohexanecarbonyl)-18-methyl-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one.
| Compound Name | 1-[3-(cyclohexanecarbonyl)-18-methyl-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one |
|---|---|
| PubChem CID | 110071824 |
| Molecular Formula | C26H39N3O2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | 1-[3-(cyclohexanecarbonyl)-18-methyl-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one |
| SMILES | CCC(=O)N1CCC2CCCC(CN(C(=O)C3CCCCC3)Cc3ccccc31)N2C |
| InChI | InChI=1S/C26H39N3O2/c1-3-25(30)29-17-16-22-13-9-14-23(27(22)2)19-28(18-21-12-7-8-15-24(21)29)26(31)20-10-5-4-6-11-20/h7-8,12,15,20,22-23H,3-6,9-11,13-14,16-19H2,1-2H3 |
| InChIKey | BTZNDGXCQILTMR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |