C32H43N3O3 — CID 110071939
1-[18-benzyl-3-(cyclohexanecarbonyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]-2-methoxyethanone (PubChem CID 110071939) has the molecular formula C32H43N3O3 and a molecular weight of 517.71 g/mol. Its IUPAC name is 1-[18-benzyl-3-(cyclohexanecarbonyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]-2-methoxyethanone.
| Compound Name | 1-[18-benzyl-3-(cyclohexanecarbonyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 110071939 |
| Molecular Formula | C32H43N3O3 |
| Molecular Weight | 517.71 g/mol |
| Exact Mass | 517.33 |
| IUPAC Name | 1-[18-benzyl-3-(cyclohexanecarbonyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCC2CCCC(CN(C(=O)C3CCCCC3)Cc3ccccc31)N2Cc1ccccc1 |
| InChI | InChI=1S/C32H43N3O3/c1-38-24-31(36)34-20-19-28-16-10-17-29(35(28)21-25-11-4-2-5-12-25)23-33(22-27-15-8-9-18-30(27)34)32(37)26-13-6-3-7-14-26/h2,4-5,8-9,11-12,15,18,26,28-29H,3,6-7,10,13-14,16-17,19-24H2,1H3 |
| InChIKey | JUWWKYXQFSHULJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.71 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |