C33H45N3O3 — CID 110071791
1-[18-benzyl-3-[3-(oxolan-2-yl)propanoyl]-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]-2-methylpropan-1-one (PubChem CID 110071791) has the molecular formula C33H45N3O3 and a molecular weight of 531.74 g/mol. Its IUPAC name is 1-[18-benzyl-3-[3-(oxolan-2-yl)propanoyl]-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]-2-methylpropan-1-one.
| Compound Name | 1-[18-benzyl-3-[3-(oxolan-2-yl)propanoyl]-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 110071791 |
| Molecular Formula | C33H45N3O3 |
| Molecular Weight | 531.74 g/mol |
| Exact Mass | 531.35 |
| IUPAC Name | 1-[18-benzyl-3-[3-(oxolan-2-yl)propanoyl]-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCC2CCCC(CN(C(=O)CCC3CCCO3)Cc3ccccc31)N2Cc1ccccc1 |
| InChI | InChI=1S/C33H45N3O3/c1-25(2)33(38)35-20-19-28-13-8-14-29(36(28)22-26-10-4-3-5-11-26)24-34(23-27-12-6-7-16-31(27)35)32(37)18-17-30-15-9-21-39-30/h3-7,10-12,16,25,28-30H,8-9,13-15,17-24H2,1-2H3 |
| InChIKey | RICFWXONUFQGLB-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.74 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |