C28H36N4O3 — CID 155993451
1-[3-(oxane-4-carbonyl)-17-(pyridin-3-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone (PubChem CID 155993451) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is 1-[3-(oxane-4-carbonyl)-17-(pyridin-3-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone.
| Compound Name | 1-[3-(oxane-4-carbonyl)-17-(pyridin-3-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone |
|---|---|
| PubChem CID | 155993451 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | 1-[3-(oxane-4-carbonyl)-17-(pyridin-3-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone |
| SMILES | CC(=O)N1CCC2CCC(CN(C(=O)C3CCOCC3)Cc3ccccc31)N2Cc1cccnc1 |
| InChI | InChI=1S/C28H36N4O3/c1-21(33)31-14-10-25-8-9-26(32(25)18-22-5-4-13-29-17-22)20-30(19-24-6-2-3-7-27(24)31)28(34)23-11-15-35-16-12-23/h2-7,13,17,23,25-26H,8-12,14-16,18-20H2,1H3 |
| InChIKey | RNTCDSGRBFGBMZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |