C26H32N4O5 — CID 110071639
2-[2-[11-acetyl-17-(pyridin-3-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-oxoethoxy]acetic acid (PubChem CID 110071639) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is 2-[2-[11-acetyl-17-(pyridin-3-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[11-acetyl-17-(pyridin-3-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 110071639 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 2-[2-[11-acetyl-17-(pyridin-3-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-oxoethoxy]acetic acid |
| SMILES | CC(=O)N1CCC2CCC(CN(C(=O)COCC(=O)O)Cc3ccccc31)N2Cc1cccnc1 |
| InChI | InChI=1S/C26H32N4O5/c1-19(31)29-12-10-22-8-9-23(30(22)14-20-5-4-11-27-13-20)16-28(25(32)17-35-18-26(33)34)15-21-6-2-3-7-24(21)29/h2-7,11,13,22-23H,8-10,12,14-18H2,1H3,(H,33,34) |
| InChIKey | CTKMOEXHABCFME-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |