C27H35N7O2S — CID 110071457
1-[11-acetyl-18-(1,3-thiazol-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-4-(1,2,4-triazol-1-yl)butan-1-one (PubChem CID 110071457) has the molecular formula C27H35N7O2S and a molecular weight of 521.69 g/mol. Its IUPAC name is 1-[11-acetyl-18-(1,3-thiazol-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-4-(1,2,4-triazol-1-yl)butan-1-one.
| Compound Name | 1-[11-acetyl-18-(1,3-thiazol-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-4-(1,2,4-triazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 110071457 |
| Molecular Formula | C27H35N7O2S |
| Molecular Weight | 521.69 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | 1-[11-acetyl-18-(1,3-thiazol-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-4-(1,2,4-triazol-1-yl)butan-1-one |
| SMILES | CC(=O)N1CCC2CCCC(CN(C(=O)CCCn3cncn3)Cc3ccccc31)N2Cc1nccs1 |
| InChI | InChI=1S/C27H35N7O2S/c1-21(35)33-14-11-23-7-4-8-24(34(23)18-26-29-12-15-37-26)17-31(16-22-6-2-3-9-25(22)33)27(36)10-5-13-32-20-28-19-30-32/h2-3,6,9,12,15,19-20,23-24H,4-5,7-8,10-11,13-14,16-18H2,1H3 |
| InChIKey | RHWBBJXOJFHZLO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 87.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.69 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |