C31H37FN4O3S — CID 110071480
1-[11-acetyl-18-(1,3-thiazol-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-4-(2-fluorophenoxy)butan-1-one (PubChem CID 110071480) has the molecular formula C31H37FN4O3S and a molecular weight of 564.73 g/mol. Its IUPAC name is 1-[11-acetyl-18-(1,3-thiazol-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-4-(2-fluorophenoxy)butan-1-one.
| Compound Name | 1-[11-acetyl-18-(1,3-thiazol-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-4-(2-fluorophenoxy)butan-1-one |
|---|---|
| PubChem CID | 110071480 |
| Molecular Formula | C31H37FN4O3S |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | 1-[11-acetyl-18-(1,3-thiazol-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-4-(2-fluorophenoxy)butan-1-one |
| SMILES | CC(=O)N1CCC2CCCC(CN(C(=O)CCCOc3ccccc3F)Cc3ccccc31)N2Cc1nccs1 |
| InChI | InChI=1S/C31H37FN4O3S/c1-23(37)35-17-15-25-9-6-10-26(36(25)22-30-33-16-19-40-30)21-34(20-24-8-2-4-12-28(24)35)31(38)14-7-18-39-29-13-5-3-11-27(29)32/h2-5,8,11-13,16,19,25-26H,6-7,9-10,14-15,17-18,20-22H2,1H3 |
| InChIKey | ZETKZDUNVYYASJ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|