C30H39N7O2 — CID 155993228
1-[11-acetyl-18-(pyridin-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-3-(3,5-dimethyl-1,2,4-triazol-1-yl)propan-1-one (PubChem CID 155993228) has the molecular formula C30H39N7O2 and a molecular weight of 529.69 g/mol. Its IUPAC name is 1-[11-acetyl-18-(pyridin-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-3-(3,5-dimethyl-1,2,4-triazol-1-yl)propan-1-one.
| Compound Name | 1-[11-acetyl-18-(pyridin-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-3-(3,5-dimethyl-1,2,4-triazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 155993228 |
| Molecular Formula | C30H39N7O2 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | 1-[11-acetyl-18-(pyridin-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-3-(3,5-dimethyl-1,2,4-triazol-1-yl)propan-1-one |
| SMILES | CC(=O)N1CCC2CCCC(CN(C(=O)CCn3nc(C)nc3C)Cc3ccccc31)N2Cc1ccccn1 |
| InChI | InChI=1S/C30H39N7O2/c1-22-32-23(2)37(33-22)18-15-30(39)34-19-25-9-4-5-13-29(25)35(24(3)38)17-14-27-11-8-12-28(21-34)36(27)20-26-10-6-7-16-31-26/h4-7,9-10,13,16,27-28H,8,11-12,14-15,17-21H2,1-3H3 |
| InChIKey | KMZUETDTSFIFET-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 87.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |