C33H40N4O4S — CID 110063191
1-[(1R,14S)-11-acetyl-17-(pyridin-2-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-3-(3,4-dimethylphenyl)sulfonylpropan-1-one (PubChem CID 110063191) has the molecular formula C33H40N4O4S and a molecular weight of 588.77 g/mol. Its IUPAC name is 1-[(1R,14S)-11-acetyl-17-(pyridin-2-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-3-(3,4-dimethylphenyl)sulfonylpropan-1-one.
| Compound Name | 1-[(1R,14S)-11-acetyl-17-(pyridin-2-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-3-(3,4-dimethylphenyl)sulfonylpropan-1-one |
|---|---|
| PubChem CID | 110063191 |
| Molecular Formula | C33H40N4O4S |
| Molecular Weight | 588.77 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | 1-[(1R,14S)-11-acetyl-17-(pyridin-2-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-3-(3,4-dimethylphenyl)sulfonylpropan-1-one |
| SMILES | CC(=O)N1CC[C@@H]2CC[C@H](CN(C(=O)CCS(=O)(=O)c3ccc(C)c(C)c3)Cc3ccccc31)N2Cc1ccccn1 |
| InChI | InChI=1S/C33H40N4O4S/c1-24-11-14-31(20-25(24)2)42(40,41)19-16-33(39)35-21-27-8-4-5-10-32(27)36(26(3)38)18-15-29-12-13-30(23-35)37(29)22-28-9-6-7-17-34-28/h4-11,14,17,20,29-30H,12-13,15-16,18-19,21-23H2,1-3H3/t29-,30+/m0/s1 |
| InChIKey | SZOUVNWADBWEPE-XZWHSSHBSA-N |
| XLogP | 4.68 |
| TPSA | 90.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.77 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |