C23H30N4O3S — CID 155993919
1-[(1S,14R)-17-methylsulfonyl-3-(pyridin-2-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone (PubChem CID 155993919) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is 1-[(1S,14R)-17-methylsulfonyl-3-(pyridin-2-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone.
| Compound Name | 1-[(1S,14R)-17-methylsulfonyl-3-(pyridin-2-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone |
|---|---|
| PubChem CID | 155993919 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 1-[(1S,14R)-17-methylsulfonyl-3-(pyridin-2-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone |
| SMILES | CC(=O)N1CC[C@H]2CC[C@@H](CN(Cc3ccccn3)Cc3ccccc31)N2S(C)(=O)=O |
| InChI | InChI=1S/C23H30N4O3S/c1-18(28)26-14-12-21-10-11-22(27(21)31(2,29)30)17-25(16-20-8-5-6-13-24-20)15-19-7-3-4-9-23(19)26/h3-9,13,21-22H,10-12,14-17H2,1-2H3/t21-,22+/m1/s1 |
| InChIKey | RMIONDGQPDBEPL-YADHBBJMSA-N |
| XLogP | 2.63 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |