C32H37FN4O3 — CID 110065912
1-[(1R,14S)-11-acetyl-17-(pyridin-2-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-4-(2-fluorophenoxy)butan-1-one (PubChem CID 110065912) has the molecular formula C32H37FN4O3 and a molecular weight of 544.67 g/mol. Its IUPAC name is 1-[(1R,14S)-11-acetyl-17-(pyridin-2-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-4-(2-fluorophenoxy)butan-1-one.
| Compound Name | 1-[(1R,14S)-11-acetyl-17-(pyridin-2-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-4-(2-fluorophenoxy)butan-1-one |
|---|---|
| PubChem CID | 110065912 |
| Molecular Formula | C32H37FN4O3 |
| Molecular Weight | 544.67 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | 1-[(1R,14S)-11-acetyl-17-(pyridin-2-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-4-(2-fluorophenoxy)butan-1-one |
| SMILES | CC(=O)N1CC[C@@H]2CC[C@H](CN(C(=O)CCCOc3ccccc3F)Cc3ccccc31)N2Cc1ccccn1 |
| InChI | InChI=1S/C32H37FN4O3/c1-24(38)36-19-17-27-15-16-28(37(27)22-26-10-6-7-18-34-26)23-35(21-25-9-2-4-12-30(25)36)32(39)14-8-20-40-31-13-5-3-11-29(31)33/h2-7,9-13,18,27-28H,8,14-17,19-23H2,1H3/t27-,28+/m0/s1 |
| InChIKey | VFYMQXOJRRUVKB-WUFINQPMSA-N |
| XLogP | 5.20 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|