C31H32Cl2FN3O2 — CID 110066333
1-[(1S,14R)-11-acetyl-17-[(4-chlorophenyl)methyl]-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-(2-chloro-6-fluorophenyl)ethanone (PubChem CID 110066333) has the molecular formula C31H32Cl2FN3O2 and a molecular weight of 568.52 g/mol. Its IUPAC name is 1-[(1S,14R)-11-acetyl-17-[(4-chlorophenyl)methyl]-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-(2-chloro-6-fluorophenyl)ethanone.
| Compound Name | 1-[(1S,14R)-11-acetyl-17-[(4-chlorophenyl)methyl]-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-(2-chloro-6-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 110066333 |
| Molecular Formula | C31H32Cl2FN3O2 |
| Molecular Weight | 568.52 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | 1-[(1S,14R)-11-acetyl-17-[(4-chlorophenyl)methyl]-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-(2-chloro-6-fluorophenyl)ethanone |
| SMILES | CC(=O)N1CC[C@H]2CC[C@@H](CN(C(=O)Cc3c(F)cccc3Cl)Cc3ccccc31)N2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H32Cl2FN3O2/c1-21(38)36-16-15-25-13-14-26(37(25)18-22-9-11-24(32)12-10-22)20-35(19-23-5-2-3-8-30(23)36)31(39)17-27-28(33)6-4-7-29(27)34/h2-12,25-26H,13-20H2,1H3/t25-,26+/m1/s1 |
| InChIKey | KVHBQISOLLPRBE-FTJBHMTQSA-N |
| XLogP | 6.49 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.52 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |