C23H33N5O2 — CID 110063774
1-(2-acetyl-2,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-10-yl)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)propan-1-one (PubChem CID 110063774) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 1-(2-acetyl-2,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-10-yl)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)propan-1-one.
| Compound Name | 1-(2-acetyl-2,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-10-yl)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 110063774 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 1-(2-acetyl-2,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-10-yl)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)propan-1-one |
| SMILES | CC(=O)N1CCCCCCCN(C(=O)CCn2nc(C)nc2C)Cc2ccccc21 |
| InChI | InChI=1S/C23H33N5O2/c1-18-24-19(2)28(25-18)16-13-23(30)26-14-9-5-4-6-10-15-27(20(3)29)22-12-8-7-11-21(22)17-26/h7-8,11-12H,4-6,9-10,13-17H2,1-3H3 |
| InChIKey | PBPKZUHGRSQRKH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |