C14H19FN2O — CID 110662297
(3-fluorophenyl)-(3,4,5-trimethylpiperazin-1-yl)methanone (PubChem CID 110662297) has the molecular formula C14H19FN2O and a molecular weight of 250.32 g/mol. Its IUPAC name is (3-fluorophenyl)-(3,4,5-trimethylpiperazin-1-yl)methanone.
| Compound Name | (3-fluorophenyl)-(3,4,5-trimethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 110662297 |
| Molecular Formula | C14H19FN2O |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | (3-fluorophenyl)-(3,4,5-trimethylpiperazin-1-yl)methanone |
| SMILES | CC1CN(C(=O)c2cccc(F)c2)CC(C)N1C |
| InChI | InChI=1S/C14H19FN2O/c1-10-8-17(9-11(2)16(10)3)14(18)12-5-4-6-13(15)7-12/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | JUBXFRGKTWNLOZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |