C12H12FNO — CID 141178396
3,6-dihydro-2H-pyridin-1-yl-(3-fluorophenyl)methanone (PubChem CID 141178396) has the molecular formula C12H12FNO and a molecular weight of 205.23 g/mol. Its IUPAC name is 3,6-dihydro-2H-pyridin-1-yl-(3-fluorophenyl)methanone.
| Compound Name | 3,6-dihydro-2H-pyridin-1-yl-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 141178396 |
| Molecular Formula | C12H12FNO |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 3,6-dihydro-2H-pyridin-1-yl-(3-fluorophenyl)methanone |
| SMILES | O=C(c1cccc(F)c1)N1CC=CCC1 |
| InChI | InChI=1S/C12H12FNO/c13-11-6-4-5-10(9-11)12(15)14-7-2-1-3-8-14/h1-2,4-6,9H,3,7-8H2 |
| InChIKey | VUZAKPNLYXUCLS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|