C11H12FNO2S — CID 110721506
(3-fluorophenyl)-(1-oxo-1,4-thiazinan-4-yl)methanone (PubChem CID 110721506) has the molecular formula C11H12FNO2S and a molecular weight of 241.29 g/mol. Its IUPAC name is (3-fluorophenyl)-(1-oxo-1,4-thiazinan-4-yl)methanone.
| Compound Name | (3-fluorophenyl)-(1-oxo-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 110721506 |
| Molecular Formula | C11H12FNO2S |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | (3-fluorophenyl)-(1-oxo-1,4-thiazinan-4-yl)methanone |
| SMILES | O=C(c1cccc(F)c1)N1CCS(=O)CC1 |
| InChI | InChI=1S/C11H12FNO2S/c12-10-3-1-2-9(8-10)11(14)13-4-6-16(15)7-5-13/h1-3,8H,4-7H2 |
| InChIKey | YBUXLNOTIUGSDD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |