C17H17NO2S — CID 110721543
(1-oxo-1,4-thiazinan-4-yl)-(3-phenylphenyl)methanone (PubChem CID 110721543) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is (1-oxo-1,4-thiazinan-4-yl)-(3-phenylphenyl)methanone.
| Compound Name | (1-oxo-1,4-thiazinan-4-yl)-(3-phenylphenyl)methanone |
|---|---|
| PubChem CID | 110721543 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (1-oxo-1,4-thiazinan-4-yl)-(3-phenylphenyl)methanone |
| SMILES | O=C(c1cccc(-c2ccccc2)c1)N1CCS(=O)CC1 |
| InChI | InChI=1S/C17H17NO2S/c19-17(18-9-11-21(20)12-10-18)16-8-4-7-15(13-16)14-5-2-1-3-6-14/h1-8,13H,9-12H2 |
| InChIKey | BTIGGIVLZDWMQO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |