C23H26N2O2 — CID 110798986
cyclobutyl-[4-(3-phenylbenzoyl)-1,4-diazepan-1-yl]methanone (PubChem CID 110798986) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is cyclobutyl-[4-(3-phenylbenzoyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | cyclobutyl-[4-(3-phenylbenzoyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 110798986 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | cyclobutyl-[4-(3-phenylbenzoyl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1cccc(-c2ccccc2)c1)N1CCCN(C(=O)C2CCC2)CC1 |
| InChI | InChI=1S/C23H26N2O2/c26-22(19-9-4-10-19)24-13-6-14-25(16-15-24)23(27)21-12-5-11-20(17-21)18-7-2-1-3-8-18/h1-3,5,7-8,11-12,17,19H,4,6,9-10,13-16H2 |
| InChIKey | CDIYLXXTMGUUNS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |