C23H27N3O2 — CID 74243293
4-(cyclobutanecarbonyl)-N-(4-phenylphenyl)-1,4-diazepane-1-carboxamide (PubChem CID 74243293) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-(cyclobutanecarbonyl)-N-(4-phenylphenyl)-1,4-diazepane-1-carboxamide.
| Compound Name | 4-(cyclobutanecarbonyl)-N-(4-phenylphenyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 74243293 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 4-(cyclobutanecarbonyl)-N-(4-phenylphenyl)-1,4-diazepane-1-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccccc2)cc1)N1CCCN(C(=O)C2CCC2)CC1 |
| InChI | InChI=1S/C23H27N3O2/c27-22(20-8-4-9-20)25-14-5-15-26(17-16-25)23(28)24-21-12-10-19(11-13-21)18-6-2-1-3-7-18/h1-3,6-7,10-13,20H,4-5,8-9,14-17H2,(H,24,28) |
| InChIKey | RFHCKCDMJQOCQB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |