C24H23NO3 — CID 74250458
[3-(4-hydroxyphenyl)phenyl]-(4-hydroxy-4-phenylpiperidin-1-yl)methanone (PubChem CID 74250458) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is [3-(4-hydroxyphenyl)phenyl]-(4-hydroxy-4-phenylpiperidin-1-yl)methanone.
| Compound Name | [3-(4-hydroxyphenyl)phenyl]-(4-hydroxy-4-phenylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 74250458 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | [3-(4-hydroxyphenyl)phenyl]-(4-hydroxy-4-phenylpiperidin-1-yl)methanone |
| SMILES | O=C(c1cccc(-c2ccc(O)cc2)c1)N1CCC(O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H23NO3/c26-22-11-9-18(10-12-22)19-5-4-6-20(17-19)23(27)25-15-13-24(28,14-16-25)21-7-2-1-3-8-21/h1-12,17,26,28H,13-16H2 |
| InChIKey | MESLPBQHERMASR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |