C20H22FNO3 — CID 95707324
[3-(4-fluorophenyl)phenyl]-[(4S)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]methanone (PubChem CID 95707324) has the molecular formula C20H22FNO3 and a molecular weight of 343.40 g/mol. Its IUPAC name is [3-(4-fluorophenyl)phenyl]-[(4S)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]methanone.
| Compound Name | [3-(4-fluorophenyl)phenyl]-[(4S)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 95707324 |
| Molecular Formula | C20H22FNO3 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | [3-(4-fluorophenyl)phenyl]-[(4S)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]methanone |
| SMILES | O=C(c1cccc(-c2ccc(F)cc2)c1)N1CCC[C@@](O)(CO)CC1 |
| InChI | InChI=1S/C20H22FNO3/c21-18-7-5-15(6-8-18)16-3-1-4-17(13-16)19(24)22-11-2-9-20(25,14-23)10-12-22/h1,3-8,13,23,25H,2,9-12,14H2/t20-/m0/s1 |
| InChIKey | UAUOSNRMKQJGEK-FQEVSTJZSA-N |
| XLogP | 2.84 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |