C16H21N5O3 — CID 95715132
[(4R)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-[4-(2-methyltetrazol-5-yl)phenyl]methanone (PubChem CID 95715132) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is [(4R)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-[4-(2-methyltetrazol-5-yl)phenyl]methanone.
| Compound Name | [(4R)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-[4-(2-methyltetrazol-5-yl)phenyl]methanone |
|---|---|
| PubChem CID | 95715132 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | [(4R)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-[4-(2-methyltetrazol-5-yl)phenyl]methanone |
| SMILES | Cn1nnc(-c2ccc(C(=O)N3CCC[C@](O)(CO)CC3)cc2)n1 |
| InChI | InChI=1S/C16H21N5O3/c1-20-18-14(17-19-20)12-3-5-13(6-4-12)15(23)21-9-2-7-16(24,11-22)8-10-21/h3-6,22,24H,2,7-11H2,1H3/t16-/m1/s1 |
| InChIKey | WFRWALQUTLGZLQ-MRXNPFEDSA-N |
| XLogP | 0.23 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |