About (8-methyl-2,8-diazaspiro[4.5]decan-2-yl)-[4-(2-methyltetrazol-5-yl)phenyl]methanone
(8-methyl-2,8-diazaspiro[4.5]decan-2-yl)-[4-(2-methyltetrazol-5-yl)phenyl]methanone (PubChem CID 50971840) has the molecular formula C18H24N6O
and a molecular weight of 340.43 g/mol. Its IUPAC name is (8-methyl-2,8-diazaspiro[4.5]decan-2-yl)-[4-(2-methyltetrazol-5-yl)phenyl]methanone.
Molecular Properties
| Compound Name | (8-methyl-2,8-diazaspiro[4.5]decan-2-yl)-[4-(2-methyltetrazol-5-yl)phenyl]methanone |
| PubChem CID | 50971840 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (8-methyl-2,8-diazaspiro[4.5]decan-2-yl)-[4-(2-methyltetrazol-5-yl)phenyl]methanone |
| SMILES | CN1CCC2(CC1)CCN(C(=O)c1ccc(-c3nnn(C)n3)cc1)C2 |
| InChI | InChI=1S/C18H24N6O/c1-22-10-7-18(8-11-22)9-12-24(13-18)17(25)15-5-3-14(4-6-15)16-19-21-23(2)20-16/h3-6H,7-13H2,1-2H3 |
| InChIKey | HXYOWBYKJWNJBB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (8-methyl-2,8-diazaspiro[4.5]decan-2-yl)-[4-(2-methyltetrazol-5-yl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methyl-2,8-diazaspiro[4.5]decan-2-yl)-[4-(2-methyltetrazol-5-yl)phenyl]methanone?
The IUPAC name of (8-methyl-2,8-diazaspiro[4.5]decan-2-yl)-[4-(2-methyltetrazol-5-yl)phenyl]methanone (CID 50971840) is (8-methyl-2,8-diazaspiro[4.5]decan-2-yl)-[4-(2-methyltetrazol-5-yl)phenyl]methanone.
What is the SMILES notation for (8-methyl-2,8-diazaspiro[4.5]decan-2-yl)-[4-(2-methyltetrazol-5-yl)phenyl]methanone?
The canonical SMILES for (8-methyl-2,8-diazaspiro[4.5]decan-2-yl)-[4-(2-methyltetrazol-5-yl)phenyl]methanone is CN1CCC2(CC1)CCN(C(=O)c1ccc(-c3nnn(C)n3)cc1)C2.
What is the InChIKey of (8-methyl-2,8-diazaspiro[4.5]decan-2-yl)-[4-(2-methyltetrazol-5-yl)phenyl]methanone?
The InChIKey is HXYOWBYKJWNJBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N6O/c1-22-10-7-18(8-11-22)9-12-24(13-18)17(25)15-5-3-14(4-6-15)16-19-21-23(2)20-16/h3-6H,7-13H2,1-2H3.
What are the key properties of (8-methyl-2,8-diazaspiro[4.5]decan-2-yl)-[4-(2-methyltetrazol-5-yl)phenyl]methanone?
(8-methyl-2,8-diazaspiro[4.5]decan-2-yl)-[4-(2-methyltetrazol-5-yl)phenyl]methanone has a molecular weight of 340.43 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methyl-2,8-diazaspiro[4.5]decan-2-yl)-[4-(2-methyltetrazol-5-yl)phenyl]methanone is sourced from PubChem (CID 50971840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).