C16H19N5O2 — CID 138379629
[2-(1-hydroxycyclopropyl)pyrrolidin-1-yl]-[4-(2-methyltetrazol-5-yl)phenyl]methanone (PubChem CID 138379629) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is [2-(1-hydroxycyclopropyl)pyrrolidin-1-yl]-[4-(2-methyltetrazol-5-yl)phenyl]methanone.
| Compound Name | [2-(1-hydroxycyclopropyl)pyrrolidin-1-yl]-[4-(2-methyltetrazol-5-yl)phenyl]methanone |
|---|---|
| PubChem CID | 138379629 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [2-(1-hydroxycyclopropyl)pyrrolidin-1-yl]-[4-(2-methyltetrazol-5-yl)phenyl]methanone |
| SMILES | Cn1nnc(-c2ccc(C(=O)N3CCCC3C3(O)CC3)cc2)n1 |
| InChI | InChI=1S/C16H19N5O2/c1-20-18-14(17-19-20)11-4-6-12(7-5-11)15(22)21-10-2-3-13(21)16(23)8-9-16/h4-7,13,23H,2-3,8-10H2,1H3 |
| InChIKey | STBFJJXRPGMEFZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |