C22H22N6O3 — CID 69413754
1-(4-benzoyl-2-methylpiperazin-1-yl)-2-[4-(2-methyltetrazol-5-yl)phenyl]ethane-1,2-dione (PubChem CID 69413754) has the molecular formula C22H22N6O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 1-(4-benzoyl-2-methylpiperazin-1-yl)-2-[4-(2-methyltetrazol-5-yl)phenyl]ethane-1,2-dione.
| Compound Name | 1-(4-benzoyl-2-methylpiperazin-1-yl)-2-[4-(2-methyltetrazol-5-yl)phenyl]ethane-1,2-dione |
|---|---|
| PubChem CID | 69413754 |
| Molecular Formula | C22H22N6O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-(4-benzoyl-2-methylpiperazin-1-yl)-2-[4-(2-methyltetrazol-5-yl)phenyl]ethane-1,2-dione |
| SMILES | CC1CN(C(=O)c2ccccc2)CCN1C(=O)C(=O)c1ccc(-c2nnn(C)n2)cc1 |
| InChI | InChI=1S/C22H22N6O3/c1-15-14-27(21(30)18-6-4-3-5-7-18)12-13-28(15)22(31)19(29)16-8-10-17(11-9-16)20-23-25-26(2)24-20/h3-11,15H,12-14H2,1-2H3 |
| InChIKey | VEPUWHFGVUVGRW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|