C26H24N4O3 — CID 59007196
1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[5-(1H-indol-5-yl)-1H-pyrrol-3-yl]ethane-1,2-dione (PubChem CID 59007196) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[5-(1H-indol-5-yl)-1H-pyrrol-3-yl]ethane-1,2-dione.
| Compound Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[5-(1H-indol-5-yl)-1H-pyrrol-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 59007196 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[5-(1H-indol-5-yl)-1H-pyrrol-3-yl]ethane-1,2-dione |
| SMILES | C[C@@H]1CN(C(=O)c2ccccc2)CCN1C(=O)C(=O)c1c[nH]c(-c2ccc3[nH]ccc3c2)c1 |
| InChI | InChI=1S/C26H24N4O3/c1-17-16-29(25(32)18-5-3-2-4-6-18)11-12-30(17)26(33)24(31)21-14-23(28-15-21)19-7-8-22-20(13-19)9-10-27-22/h2-10,13-15,17,27-28H,11-12,16H2,1H3/t17-/m1/s1 |
| InChIKey | JOTOLABMESXGQL-QGZVFWFLSA-N |
| XLogP | 3.72 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|