C23H20BrN3O3 — CID 5280291
1-(4-benzoyl-2-methylpiperazin-1-yl)-2-(6-bromoquinolin-2-yl)ethane-1,2-dione (PubChem CID 5280291) has the molecular formula C23H20BrN3O3 and a molecular weight of 466.34 g/mol. Its IUPAC name is 1-(4-benzoyl-2-methylpiperazin-1-yl)-2-(6-bromoquinolin-2-yl)ethane-1,2-dione.
| Compound Name | 1-(4-benzoyl-2-methylpiperazin-1-yl)-2-(6-bromoquinolin-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 5280291 |
| Molecular Formula | C23H20BrN3O3 |
| Molecular Weight | 466.34 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 1-(4-benzoyl-2-methylpiperazin-1-yl)-2-(6-bromoquinolin-2-yl)ethane-1,2-dione |
| SMILES | CC1CN(C(=O)c2ccccc2)CCN1C(=O)C(=O)c1ccc2cc(Br)ccc2n1 |
| InChI | InChI=1S/C23H20BrN3O3/c1-15-14-26(22(29)16-5-3-2-4-6-16)11-12-27(15)23(30)21(28)20-9-7-17-13-18(24)8-10-19(17)25-20/h2-10,13,15H,11-12,14H2,1H3 |
| InChIKey | FULSUCQMUMKHIZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|