C44H40N8O8 — CID 161289357
3-[2-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-oxoacetyl]-1H-pyrrolo[3,2-b]pyridine-7-carbaldehyde (PubChem CID 161289357) has the molecular formula C44H40N8O8 and a molecular weight of 808.85 g/mol. Its IUPAC name is 3-[2-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-oxoacetyl]-1H-pyrrolo[3,2-b]pyridine-7-carbaldehyde.
| Compound Name | 3-[2-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-oxoacetyl]-1H-pyrrolo[3,2-b]pyridine-7-carbaldehyde |
|---|---|
| PubChem CID | 161289357 |
| Molecular Formula | C44H40N8O8 |
| Molecular Weight | 808.85 g/mol |
| Exact Mass | 808.30 |
| IUPAC Name | 3-[2-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-oxoacetyl]-1H-pyrrolo[3,2-b]pyridine-7-carbaldehyde |
| SMILES | C[C@@H]1CN(C(=O)c2ccccc2)CCN1C(=O)C(=O)c1c[nH]c2c(C=O)ccnc12.C[C@@H]1CN(C(=O)c2ccccc2)CCN1C(=O)C(=O)c1c[nH]c2c(C=O)ccnc12 |
| InChI | InChI=1S/2C22H20N4O4/c2*1-14-12-25(21(29)15-5-3-2-4-6-15)9-10-26(14)22(30)20(28)17-11-24-18-16(13-27)7-8-23-19(17)18/h2*2-8,11,13-14,24H,9-10,12H2,1H3/t2*14-/m11/s1 |
| InChIKey | VGDKGEGHZZQAST-RPERETBRSA-N |
| XLogP | 3.86 |
| TPSA | 206.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.85 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|