C22H23N5O3 — CID 5495835
1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[4-(methylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethane-1,2-dione (PubChem CID 5495835) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[4-(methylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[4-(methylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 5495835 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[4-(methylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethane-1,2-dione |
| SMILES | CNc1ccnc2[nH]cc(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)C[C@H]3C)c12 |
| InChI | InChI=1S/C22H23N5O3/c1-14-13-26(21(29)15-6-4-3-5-7-15)10-11-27(14)22(30)19(28)16-12-25-20-18(16)17(23-2)8-9-24-20/h3-9,12,14H,10-11,13H2,1-2H3,(H2,23,24,25)/t14-/m1/s1 |
| InChIKey | WGYVWRIJVPIZMV-CQSZACIVSA-N |
| XLogP | 2.16 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|