C21H19IN4O4 — CID 67121967
1-[(2R)-4-benzoyl-2-iodopiperazin-1-yl]-2-(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)ethane-1,2-dione (PubChem CID 67121967) has the molecular formula C21H19IN4O4 and a molecular weight of 518.31 g/mol. Its IUPAC name is 1-[(2R)-4-benzoyl-2-iodopiperazin-1-yl]-2-(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)ethane-1,2-dione.
| Compound Name | 1-[(2R)-4-benzoyl-2-iodopiperazin-1-yl]-2-(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 67121967 |
| Molecular Formula | C21H19IN4O4 |
| Molecular Weight | 518.31 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | 1-[(2R)-4-benzoyl-2-iodopiperazin-1-yl]-2-(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)ethane-1,2-dione |
| SMILES | COc1ccnc2[nH]cc(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)C[C@H]3I)c12 |
| InChI | InChI=1S/C21H19IN4O4/c1-30-15-7-8-23-19-17(15)14(11-24-19)18(27)21(29)26-10-9-25(12-16(26)22)20(28)13-5-3-2-4-6-13/h2-8,11,16H,9-10,12H2,1H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | VZKKDPXQOXZUAS-INIZCTEOSA-N |
| XLogP | 2.50 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|