C21H20N8O3 — CID 24874962
1-(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 24874962) has the molecular formula C21H20N8O3 and a molecular weight of 432.44 g/mol. Its IUPAC name is 1-(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 24874962 |
| Molecular Formula | C21H20N8O3 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 1-(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | COc1ccnc2[nH]cc(C(=O)C(=O)N3CCN(c4nnnn4-c4ccccc4)CC3)c12 |
| InChI | InChI=1S/C21H20N8O3/c1-32-16-7-8-22-19-17(16)15(13-23-19)18(30)20(31)27-9-11-28(12-10-27)21-24-25-26-29(21)14-5-3-2-4-6-14/h2-8,13H,9-12H2,1H3,(H,22,23) |
| InChIKey | FYGOIMBZZFGGKI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|