C23H22FN9O3 — CID 90807925
1-[4-fluoro-7-[1-(methoxyamino)ethenyl]-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 90807925) has the molecular formula C23H22FN9O3 and a molecular weight of 491.49 g/mol. Its IUPAC name is 1-[4-fluoro-7-[1-(methoxyamino)ethenyl]-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[4-fluoro-7-[1-(methoxyamino)ethenyl]-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 90807925 |
| Molecular Formula | C23H22FN9O3 |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 1-[4-fluoro-7-[1-(methoxyamino)ethenyl]-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | C=C(NOC)c1ncc(F)c2c(C(=O)C(=O)N3CCN(c4nnnn4-c4ccccc4)CC3)c[nH]c12 |
| InChI | InChI=1S/C23H22FN9O3/c1-14(28-36-2)19-20-18(17(24)13-26-19)16(12-25-20)21(34)22(35)31-8-10-32(11-9-31)23-27-29-30-33(23)15-6-4-3-5-7-15/h3-7,12-13,25,28H,1,8-11H2,2H3 |
| InChIKey | KQZVNIODJRYLGE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 134.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|