C24H24FN11O2 — CID 71157620
1-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[(3S)-3-methyl-4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 71157620) has the molecular formula C24H24FN11O2 and a molecular weight of 517.53 g/mol. Its IUPAC name is 1-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[(3S)-3-methyl-4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[(3S)-3-methyl-4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 71157620 |
| Molecular Formula | C24H24FN11O2 |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | 1-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[(3S)-3-methyl-4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | C=N/C=C\N(N)c1ncc(F)c2c(C(=O)C(=O)N3CCN(c4nnnn4-c4ccccc4)[C@@H](C)C3)c[nH]c12 |
| InChI | InChI=1S/C24H24FN11O2/c1-15-14-33(10-11-34(15)24-30-31-32-36(24)16-6-4-3-5-7-16)23(38)21(37)17-12-28-20-19(17)18(25)13-29-22(20)35(26)9-8-27-2/h3-9,12-13,15,28H,2,10-11,14,26H2,1H3/b9-8-/t15-/m0/s1 |
| InChIKey | KMEDYBYGKSKEKX-CDNLZTBQSA-N |
| XLogP | 1.45 |
| TPSA | 154.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|