C24H25FN7O7P — CID 71132477
[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoropyrrolo[2,3-c]pyridin-1-yl]methyl dihydrogen phosphate (PubChem CID 71132477) has the molecular formula C24H25FN7O7P and a molecular weight of 573.48 g/mol. Its IUPAC name is [7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoropyrrolo[2,3-c]pyridin-1-yl]methyl dihydrogen phosphate.
| Compound Name | [7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoropyrrolo[2,3-c]pyridin-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 71132477 |
| Molecular Formula | C24H25FN7O7P |
| Molecular Weight | 573.48 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | [7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoropyrrolo[2,3-c]pyridin-1-yl]methyl dihydrogen phosphate |
| SMILES | C=N/C=C\N(N)c1ncc(F)c2c(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)CC3)cn(COP(=O)(O)O)c12 |
| InChI | InChI=1S/C24H25FN7O7P/c1-27-7-8-32(26)22-20-19(18(25)13-28-22)17(14-31(20)15-39-40(36,37)38)21(33)24(35)30-11-9-29(10-12-30)23(34)16-5-3-2-4-6-16/h2-8,13-14H,1,9-12,15,26H2,(H2,36,37,38)/b8-7- |
| InChIKey | SGCACJOGWCJQDA-FPLPWBNLSA-N |
| XLogP | 1.26 |
| TPSA | 183.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.48 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|