C24H27N4O9P — CID 71132478
[3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4,7-dimethoxypyrrolo[2,3-c]pyridin-1-yl]methyl methyl hydrogen phosphate (PubChem CID 71132478) has the molecular formula C24H27N4O9P and a molecular weight of 546.47 g/mol. Its IUPAC name is [3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4,7-dimethoxypyrrolo[2,3-c]pyridin-1-yl]methyl methyl hydrogen phosphate.
| Compound Name | [3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4,7-dimethoxypyrrolo[2,3-c]pyridin-1-yl]methyl methyl hydrogen phosphate |
|---|---|
| PubChem CID | 71132478 |
| Molecular Formula | C24H27N4O9P |
| Molecular Weight | 546.47 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | [3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4,7-dimethoxypyrrolo[2,3-c]pyridin-1-yl]methyl methyl hydrogen phosphate |
| SMILES | COc1cnc(OC)c2c1c(C(=O)C(=O)N1CCN(C(=O)c3ccccc3)CC1)cn2COP(=O)(O)OC |
| InChI | InChI=1S/C24H27N4O9P/c1-34-18-13-25-22(35-2)20-19(18)17(14-28(20)15-37-38(32,33)36-3)21(29)24(31)27-11-9-26(10-12-27)23(30)16-7-5-4-6-8-16/h4-8,13-14H,9-12,15H2,1-3H3,(H,32,33) |
| InChIKey | QEDWEKAYLIZLBN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 149.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|